C67H49N5 — CID 155279556
9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole (PubChem CID 155279556) has the molecular formula C67H49N5 and a molecular weight of 924.16 g/mol. Its IUPAC name is 9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole.
| Compound Name | 9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole |
|---|---|
| PubChem CID | 155279556 |
| Molecular Formula | C67H49N5 |
| Molecular Weight | 924.16 g/mol |
| Exact Mass | 923.40 |
| IUPAC Name | 9-[4-(2-carbazol-9-ylphenyl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(3,5-dimethylphenyl)carbazole |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)c2cc(-c4cc(C)cc(C)c4)ccc2n3-c2ccc(-c3ccccc3-n3c4ccccc4c4ccccc43)cc2-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C67H49N5/c1-42-33-43(2)36-51(35-42)48-27-30-62-56(39-48)57-40-49(52-37-44(3)34-45(4)38-52)28-31-63(57)72(62)64-32-29-50(53-21-11-14-24-59(53)71-60-25-15-12-22-54(60)55-23-13-16-26-61(55)71)41-58(64)67-69-65(46-17-7-5-8-18-46)68-66(70-67)47-19-9-6-10-20-47/h5-41H,1-4H3 |
| InChIKey | LOMCNYCQKZUFPA-UHFFFAOYSA-N |
| XLogP | 17.30 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.16 |
| LogP ≤ 5 | 17.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |