C23H21FN6O3S — CID 155279916
4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanyl-hydroxyamino]benzoic acid (PubChem CID 155279916) has the molecular formula C23H21FN6O3S and a molecular weight of 480.53 g/mol. Its IUPAC name is 4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanyl-hydroxyamino]benzoic acid.
| Compound Name | 4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanyl-hydroxyamino]benzoic acid |
|---|---|
| PubChem CID | 155279916 |
| Molecular Formula | C23H21FN6O3S |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 4-cyclopropyl-3-[[4-fluoro-5-(2-methyl-1,2,4-triazol-3-yl)-2-pyrrol-1-ylanilino]sulfanyl-hydroxyamino]benzoic acid |
| SMILES | Cn1ncnc1-c1cc(NSN(O)c2cc(C(=O)O)ccc2C2CC2)c(-n2cccc2)cc1F |
| InChI | InChI=1S/C23H21FN6O3S/c1-28-22(25-13-26-28)17-11-19(21(12-18(17)24)29-8-2-3-9-29)27-34-30(33)20-10-15(23(31)32)6-7-16(20)14-4-5-14/h2-3,6-14,27,33H,4-5H2,1H3,(H,31,32) |
| InChIKey | IJBNESQNSPYWJM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|