C23H18FN3O2S2 — CID 155280122
4-cyclopropyl-3-[4-fluoro-2-pyrrol-1-yl-5-(1,2-thiazol-5-yl)anilino]sulfanylbenzoic acid (PubChem CID 155280122) has the molecular formula C23H18FN3O2S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 4-cyclopropyl-3-[4-fluoro-2-pyrrol-1-yl-5-(1,2-thiazol-5-yl)anilino]sulfanylbenzoic acid.
| Compound Name | 4-cyclopropyl-3-[4-fluoro-2-pyrrol-1-yl-5-(1,2-thiazol-5-yl)anilino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 155280122 |
| Molecular Formula | C23H18FN3O2S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-cyclopropyl-3-[4-fluoro-2-pyrrol-1-yl-5-(1,2-thiazol-5-yl)anilino]sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccc(C2CC2)c(SNc2cc(-c3ccns3)c(F)cc2-n2cccc2)c1 |
| InChI | InChI=1S/C23H18FN3O2S2/c24-18-13-20(27-9-1-2-10-27)19(12-17(18)21-7-8-25-30-21)26-31-22-11-15(23(28)29)5-6-16(22)14-3-4-14/h1-2,5-14,26H,3-4H2,(H,28,29) |
| InChIKey | OWQKOEWXZGAGER-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|