C23H23N7O3 — CID 155280515
ethyl 2-[4-[[7-[[3-(prop-2-enoylamino)phenyl]methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate (PubChem CID 155280515) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is ethyl 2-[4-[[7-[[3-(prop-2-enoylamino)phenyl]methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[7-[[3-(prop-2-enoylamino)phenyl]methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 155280515 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | ethyl 2-[4-[[7-[[3-(prop-2-enoylamino)phenyl]methyl]pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate |
| SMILES | C=CC(=O)Nc1cccc(Cn2ccc3cnc(Nc4cnn(CC(=O)OCC)c4)nc32)c1 |
| InChI | InChI=1S/C23H23N7O3/c1-3-20(31)26-18-7-5-6-16(10-18)13-29-9-8-17-11-24-23(28-22(17)29)27-19-12-25-30(14-19)15-21(32)33-4-2/h3,5-12,14H,1,4,13,15H2,2H3,(H,26,31)(H,24,27,28) |
| InChIKey | HIGWEXQEAYSZLH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|