C21H27N7O2 — CID 155280654
2-cyanoethyl 2-[4-[[7-(2-ethyl-3-methylbutyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate (PubChem CID 155280654) has the molecular formula C21H27N7O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-cyanoethyl 2-[4-[[7-(2-ethyl-3-methylbutyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate.
| Compound Name | 2-cyanoethyl 2-[4-[[7-(2-ethyl-3-methylbutyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 155280654 |
| Molecular Formula | C21H27N7O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-cyanoethyl 2-[4-[[7-(2-ethyl-3-methylbutyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]pyrazol-1-yl]acetate |
| SMILES | CCC(Cn1ccc2cnc(Nc3cnn(CC(=O)OCCC#N)c3)nc21)C(C)C |
| InChI | InChI=1S/C21H27N7O2/c1-4-16(15(2)3)12-27-8-6-17-10-23-21(26-20(17)27)25-18-11-24-28(13-18)14-19(29)30-9-5-7-22/h6,8,10-11,13,15-16H,4-5,9,12,14H2,1-3H3,(H,23,25,26) |
| InChIKey | RFBTXUMZTMLSRW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|