C20H21F4N3O3 — CID 155280841
methyl N-[1-(3-fluorophenyl)ethenyl]-4-oxo-2-[[(E)-5,5,5-trifluoro-2-methyl-4-methyliminopent-2-enoyl]amino]butanimidate (PubChem CID 155280841) has the molecular formula C20H21F4N3O3 and a molecular weight of 427.40 g/mol. Its IUPAC name is methyl N-[1-(3-fluorophenyl)ethenyl]-4-oxo-2-[[(E)-5,5,5-trifluoro-2-methyl-4-methyliminopent-2-enoyl]amino]butanimidate.
| Compound Name | methyl N-[1-(3-fluorophenyl)ethenyl]-4-oxo-2-[[(E)-5,5,5-trifluoro-2-methyl-4-methyliminopent-2-enoyl]amino]butanimidate |
|---|---|
| PubChem CID | 155280841 |
| Molecular Formula | C20H21F4N3O3 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | methyl N-[1-(3-fluorophenyl)ethenyl]-4-oxo-2-[[(E)-5,5,5-trifluoro-2-methyl-4-methyliminopent-2-enoyl]amino]butanimidate |
| SMILES | C=C(/N=C(\OC)C(CC=O)NC(=O)/C(C)=C/C(=N/C)C(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C20H21F4N3O3/c1-12(10-17(25-3)20(22,23)24)18(29)27-16(8-9-28)19(30-4)26-13(2)14-6-5-7-15(21)11-14/h5-7,9-11,16H,2,8H2,1,3-4H3,(H,27,29)/b12-10+,25-17-,26-19- |
| InChIKey | DZFMBPLIDGDYBE-JWLCNLHYSA-N |
| XLogP | 3.49 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|