About (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one
(E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one (PubChem CID 155280906) has the molecular formula C9H12F3NO
and a molecular weight of 207.19 g/mol. Its IUPAC name is (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one.
Molecular Properties
| Compound Name | (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one |
| PubChem CID | 155280906 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one |
| SMILES | CCC(=O)/C(C)=C/C(=N\C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO/c1-4-7(14)6(2)5-8(13-3)9(10,11)12/h5H,4H2,1-3H3/b6-5+,13-8+ |
| InChIKey | ZQJPFSCBZXUAHG-RJZLBLBSSA-N |
| XLogP | 2.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one?
The IUPAC name of (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one (CID 155280906) is (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one.
What is the SMILES notation for (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one?
The canonical SMILES for (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one is CCC(=O)/C(C)=C/C(=N\C)C(F)(F)F.
What is the InChIKey of (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one?
The InChIKey is ZQJPFSCBZXUAHG-RJZLBLBSSA-N. The full InChI is InChI=1S/C9H12F3NO/c1-4-7(14)6(2)5-8(13-3)9(10,11)12/h5H,4H2,1-3H3/b6-5+,13-8+.
What are the key properties of (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one?
(E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one has a molecular weight of 207.19 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7,7,7-trifluoro-4-methyl-6-methyliminohept-4-en-3-one is sourced from PubChem (CID 155280906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).