C8H16N2 — CID 155281370
(1E)-1-N-ethyl-1-N,3-dimethylbuta-1,3-diene-1,2-diamine (PubChem CID 155281370) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (1E)-1-N-ethyl-1-N,3-dimethylbuta-1,3-diene-1,2-diamine.
| Compound Name | (1E)-1-N-ethyl-1-N,3-dimethylbuta-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 155281370 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (1E)-1-N-ethyl-1-N,3-dimethylbuta-1,3-diene-1,2-diamine |
| SMILES | C=C(C)/C(N)=C\N(C)CC |
| InChI | InChI=1S/C8H16N2/c1-5-10(4)6-8(9)7(2)3/h6H,2,5,9H2,1,3-4H3/b8-6+ |
| InChIKey | JRQPHLJOUDFSPN-SOFGYWHQSA-N |
| XLogP | 1.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|