C21H28N4O4 — CID 155281627
4-hydroxy-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-4-methylpiperidine-1-carboxamide (PubChem CID 155281627) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-hydroxy-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-4-methylpiperidine-1-carboxamide.
| Compound Name | 4-hydroxy-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 155281627 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 4-hydroxy-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-4-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(C2CCOCC2)c2ncc(NC(=O)N3CCC(C)(O)CC3)nc12 |
| InChI | InChI=1S/C21H28N4O4/c1-21(27)7-9-25(10-8-21)20(26)24-17-13-22-18-15(14-5-11-29-12-6-14)3-4-16(28-2)19(18)23-17/h3-4,13-14,27H,5-12H2,1-2H3,(H,23,24,26) |
| InChIKey | UCXRQQXKGCKCMN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |