C26H30N8O — CID 155282305
Vustanaciclib (PubChem CID 155282305) has the molecular formula C26H30N8O and a molecular weight of 470.60 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-1-[6-[[4-(3-propan-2-ylpyrazolo[1,5-a]pyridin-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]piperidin-2-one.
| Compound Name | Vustanaciclib |
|---|---|
| PubChem CID | 155282305 |
| Molecular Formula | C26H30N8O |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | (4S)-4-(dimethylamino)-1-[6-[[4-(3-propan-2-ylpyrazolo[1,5-a]pyridin-5-yl)pyrimidin-2-yl]amino]-3-pyridinyl]piperidin-2-one |
| SMILES | CC(C)C1=C2C=C(C=CN2N=C1)C3=NC(=NC=C3)NC4=NC=C(C=C4)N5CC[C@@H](CC5=O)N(C)C |
| InChI | InChI=1S/C26H30N8O/c1-17(2)21-16-29-34-12-8-18(13-23(21)34)22-7-10-27-26(30-22)31-24-6-5-20(15-28-24)33-11-9-19(32(3)4)14-25(33)35/h5-8,10,12-13,15-17,19H,9,11,14H2,1-4H3,(H,27,28,30,31)/t19-/m0/s1 |
| InChIKey | QZJWVFBTMGPBPY-IBGZPJMESA-N |
| XLogP | 2.80 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | 719 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |