C16H23F3N4O2S — CID 155282966
6,6-dimethyl-4-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one (PubChem CID 155282966) has the molecular formula C16H23F3N4O2S and a molecular weight of 392.45 g/mol. Its IUPAC name is 6,6-dimethyl-4-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one.
| Compound Name | 6,6-dimethyl-4-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 155282966 |
| Molecular Formula | C16H23F3N4O2S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 6,6-dimethyl-4-[3-[[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-5-one |
| SMILES | CSc1ncc(C(F)(F)F)c(NCCCN2CCOCC(C)(C)C2=O)n1 |
| InChI | InChI=1S/C16H23F3N4O2S/c1-15(2)10-25-8-7-23(13(15)24)6-4-5-20-12-11(16(17,18)19)9-21-14(22-12)26-3/h9H,4-8,10H2,1-3H3,(H,20,21,22) |
| InChIKey | CFXHHCZMSVTPDZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|