C12H19N3O — CID 155282968
(4aS)-3-methyl-2,4,4a,5,9,10-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine (PubChem CID 155282968) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (4aS)-3-methyl-2,4,4a,5,9,10-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine.
| Compound Name | (4aS)-3-methyl-2,4,4a,5,9,10-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine |
|---|---|
| PubChem CID | 155282968 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (4aS)-3-methyl-2,4,4a,5,9,10-hexahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-amine |
| SMILES | CN1CCN2C3=C(C=C(N)CC3)OC[C@@H]2C1 |
| InChI | InChI=1S/C12H19N3O/c1-14-4-5-15-10(7-14)8-16-12-6-9(13)2-3-11(12)15/h6,10H,2-5,7-8,13H2,1H3/t10-/m0/s1 |
| InChIKey | PWTROYBKVHWKEP-JTQLQIEISA-N |
| XLogP | 0.48 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |