C13H10N2O2S — CID 155283013
5-methyl-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaen-6-amine (PubChem CID 155283013) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 5-methyl-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaen-6-amine.
| Compound Name | 5-methyl-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaen-6-amine |
|---|---|
| PubChem CID | 155283013 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-methyl-12,14-dioxa-4-thia-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1,3(7),5,8,10,15-hexaen-6-amine |
| SMILES | Cc1sc2nc3cc4c(cc3cc2c1N)OCO4 |
| InChI | InChI=1S/C13H10N2O2S/c1-6-12(14)8-2-7-3-10-11(17-5-16-10)4-9(7)15-13(8)18-6/h2-4H,5,14H2,1H3 |
| InChIKey | TXTHDPVLHLZGOA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |