About N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide
N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide (PubChem CID 155283123) has the molecular formula C18H15ClFNO3S
and a molecular weight of 379.84 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide.
Molecular Properties
| Compound Name | N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide |
| PubChem CID | 155283123 |
| Molecular Formula | C18H15ClFNO3S |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)/N=C/C2CCc3cc(Cl)ccc32)c(F)c1 |
| InChI | InChI=1S/C18H15ClFNO3S/c1-25(23,24)14-5-7-16(17(20)9-14)18(22)21-10-12-3-2-11-8-13(19)4-6-15(11)12/h4-10,12H,2-3H2,1H3/b21-10+ |
| InChIKey | QPQUWAWIFUCMAK-UFFVCSGVSA-N |
| XLogP | 3.82 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide?
The IUPAC name of N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide (CID 155283123) is N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide.
What is the SMILES notation for N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide?
The canonical SMILES for N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide is CS(=O)(=O)c1ccc(C(=O)/N=C/C2CCc3cc(Cl)ccc32)c(F)c1.
What is the InChIKey of N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide?
The InChIKey is QPQUWAWIFUCMAK-UFFVCSGVSA-N. The full InChI is InChI=1S/C18H15ClFNO3S/c1-25(23,24)14-5-7-16(17(20)9-14)18(22)21-10-12-3-2-11-8-13(19)4-6-15(11)12/h4-10,12H,2-3H2,1H3/b21-10+.
What are the key properties of N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide?
N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide has a molecular weight of 379.84 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chloro-2,3-dihydro-1H-inden-1-yl)methylidene]-2-fluoro-4-methylsulfonylbenzamide is sourced from PubChem (CID 155283123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).