About (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole
(5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole (PubChem CID 155283699) has the molecular formula C12H12FN
and a molecular weight of 189.23 g/mol. Its IUPAC name is (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole.
Molecular Properties
| Compound Name | (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole |
| PubChem CID | 155283699 |
| Molecular Formula | C12H12FN |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole |
| SMILES | C=Cc1[nH]/c(=C/C(=C)F)c(=C)c1C=C |
| InChI | InChI=1S/C12H12FN/c1-5-10-9(4)12(7-8(3)13)14-11(10)6-2/h5-7,14H,1-4H2/b12-7+ |
| InChIKey | MWYPPRMBELDKAE-KPKJPENVSA-N |
| XLogP | 1.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole?
The IUPAC name of (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole (CID 155283699) is (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole.
What is the SMILES notation for (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole?
The canonical SMILES for (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole is C=Cc1[nH]/c(=C/C(=C)F)c(=C)c1C=C.
What is the InChIKey of (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole?
The InChIKey is MWYPPRMBELDKAE-KPKJPENVSA-N. The full InChI is InChI=1S/C12H12FN/c1-5-10-9(4)12(7-8(3)13)14-11(10)6-2/h5-7,14H,1-4H2/b12-7+.
What are the key properties of (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole?
(5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole has a molecular weight of 189.23 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2,3-bis(ethenyl)-5-(2-fluoroprop-2-enylidene)-4-methylidene-1H-pyrrole is sourced from PubChem (CID 155283699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).