C32H34O4S6 — CID 15528383
20-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene (PubChem CID 15528383) has the molecular formula C32H34O4S6 and a molecular weight of 675.02 g/mol. Its IUPAC name is 20-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene.
| Compound Name | 20-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene |
|---|---|
| PubChem CID | 15528383 |
| Molecular Formula | C32H34O4S6 |
| Molecular Weight | 675.02 g/mol |
| Exact Mass | 674.08 |
| IUPAC Name | 20-[10-(4,5-dimethyl-1,3-dithiol-2-ylidene)anthracen-9-ylidene]-5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-ene |
| SMILES | CC1=C(C)SC(=c2c3ccccc3c(=C3SC4=C(SCCOCCOCCOCCOCCS4)S3)c3ccccc23)S1 |
| InChI | InChI=1S/C32H34O4S6/c1-21-22(2)40-29(39-21)27-23-7-3-5-9-25(23)28(26-10-6-4-8-24(26)27)30-41-31-32(42-30)38-20-18-36-16-14-34-12-11-33-13-15-35-17-19-37-31/h3-10H,11-20H2,1-2H3 |
| InChIKey | YAFPRAJPMBBRRX-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.02 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|