C19H29N3O4 — CID 155283919
3-ethyl-6-(3-oxospiro[5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,4'-piperidine]-1'-yl)-2-azaspiro[3.3]heptane-2-carboxylic acid (PubChem CID 155283919) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-ethyl-6-(3-oxospiro[5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,4'-piperidine]-1'-yl)-2-azaspiro[3.3]heptane-2-carboxylic acid.
| Compound Name | 3-ethyl-6-(3-oxospiro[5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,4'-piperidine]-1'-yl)-2-azaspiro[3.3]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 155283919 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 3-ethyl-6-(3-oxospiro[5,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,4'-piperidine]-1'-yl)-2-azaspiro[3.3]heptane-2-carboxylic acid |
| SMILES | CCC1N(C(=O)O)CC12CC(N1CCC3(CC1)OC(=O)N1CCCC13)C2 |
| InChI | InChI=1S/C19H29N3O4/c1-2-14-18(12-22(14)16(23)24)10-13(11-18)20-8-5-19(6-9-20)15-4-3-7-21(15)17(25)26-19/h13-15H,2-12H2,1H3,(H,23,24) |
| InChIKey | DSOUIZDHRMIEKB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |