C28H28F3NO4 — CID 155284151
[3-[2-[[1-(2,4-dimethylphenyl)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 155284151) has the molecular formula C28H28F3NO4 and a molecular weight of 499.53 g/mol. Its IUPAC name is [3-[2-[[1-(2,4-dimethylphenyl)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[2-[[1-(2,4-dimethylphenyl)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155284151 |
| Molecular Formula | C28H28F3NO4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | [3-[2-[[1-(2,4-dimethylphenyl)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc2c(cc1OCCc1cccc(OC(=O)C(F)(F)F)c1)C(c1ccc(C)cc1C)NCC2 |
| InChI | InChI=1S/C28H28F3NO4/c1-17-7-8-22(18(2)13-17)26-23-16-25(24(34-3)15-20(23)9-11-32-26)35-12-10-19-5-4-6-21(14-19)36-27(33)28(29,30)31/h4-8,13-16,26,32H,9-12H2,1-3H3 |
| InChIKey | XSPREDYPTYTHMR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|