C19H22Cl2IN3O4 — CID 155284302
2-[carboxy-[2-[3-[(3,5-dichlorophenyl)methyl]imidazol-4-yl]-1-iodoethyl]amino]-4-methylpentanoic acid (PubChem CID 155284302) has the molecular formula C19H22Cl2IN3O4 and a molecular weight of 554.21 g/mol. Its IUPAC name is 2-[carboxy-[2-[3-[(3,5-dichlorophenyl)methyl]imidazol-4-yl]-1-iodoethyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[carboxy-[2-[3-[(3,5-dichlorophenyl)methyl]imidazol-4-yl]-1-iodoethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 155284302 |
| Molecular Formula | C19H22Cl2IN3O4 |
| Molecular Weight | 554.21 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | 2-[carboxy-[2-[3-[(3,5-dichlorophenyl)methyl]imidazol-4-yl]-1-iodoethyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N(C(=O)O)C(I)Cc1cncn1Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2IN3O4/c1-11(2)3-16(18(26)27)25(19(28)29)17(22)7-15-8-23-10-24(15)9-12-4-13(20)6-14(21)5-12/h4-6,8,10-11,16-17H,3,7,9H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | QUHRZEKZESZVDV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.21 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|