C22H24F3N5O2 — CID 155284469
(1R,5S)-8-azido-N-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methyl]bicyclo[3.2.1]octan-3-amine (PubChem CID 155284469) has the molecular formula C22H24F3N5O2 and a molecular weight of 447.46 g/mol. Its IUPAC name is (1R,5S)-8-azido-N-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methyl]bicyclo[3.2.1]octan-3-amine.
| Compound Name | (1R,5S)-8-azido-N-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methyl]bicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 155284469 |
| Molecular Formula | C22H24F3N5O2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (1R,5S)-8-azido-N-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methyl]bicyclo[3.2.1]octan-3-amine |
| SMILES | [N-]=[N+]=NC1[C@@H]2CC[C@H]1CC(NCc1c(-c3ccccc3OC(F)(F)F)noc1C1CC1)C2 |
| InChI | InChI=1S/C22H24F3N5O2/c23-22(24,25)31-18-4-2-1-3-16(18)20-17(21(32-29-20)12-5-6-12)11-27-15-9-13-7-8-14(10-15)19(13)28-30-26/h1-4,12-15,19,27H,5-11H2/t13-,14+,15?,19? |
| InChIKey | KNDLRWJDPZESOQ-WWMCIYDGSA-N |
| XLogP | 6.07 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|