C20H20Cl2N4O2 — CID 155284528
4-[[(1S,2S,4S,5S)-5-azido-2-bicyclo[2.2.1]heptanyl]oxymethyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole (PubChem CID 155284528) has the molecular formula C20H20Cl2N4O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is 4-[[(1S,2S,4S,5S)-5-azido-2-bicyclo[2.2.1]heptanyl]oxymethyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole.
| Compound Name | 4-[[(1S,2S,4S,5S)-5-azido-2-bicyclo[2.2.1]heptanyl]oxymethyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 155284528 |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[[(1S,2S,4S,5S)-5-azido-2-bicyclo[2.2.1]heptanyl]oxymethyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole |
| SMILES | [N-]=[N+]=N[C@H]1C[C@@H]2C[C@H]1C[C@@H]2OCc1c(-c2c(Cl)cccc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C20H20Cl2N4O2/c21-14-2-1-3-15(22)18(14)19-13(20(28-25-19)10-4-5-10)9-27-17-8-11-6-12(17)7-16(11)24-26-23/h1-3,10-12,16-17H,4-9H2/t11-,12-,16-,17-/m0/s1 |
| InChIKey | HGFCMFFMHXJHOT-SYWGBEHUSA-N |
| XLogP | 6.52 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|