About 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol
2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol (PubChem CID 155284548) has the molecular formula C17H17F5N4O
and a molecular weight of 388.34 g/mol. Its IUPAC name is 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol |
| PubChem CID | 155284548 |
| Molecular Formula | C17H17F5N4O |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc(C(F)(F)F)cc(O)c1-c1ccc(NC2CNCC(F)(F)C2)nn1 |
| InChI | InChI=1S/C17H17F5N4O/c1-9-4-10(17(20,21)22)5-13(27)15(9)12-2-3-14(26-25-12)24-11-6-16(18,19)8-23-7-11/h2-5,11,23,27H,6-8H2,1H3,(H,24,26) |
| InChIKey | XUJSDUINYJMZDV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol?
The IUPAC name of 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol (CID 155284548) is 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol.
What is the SMILES notation for 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol?
The canonical SMILES for 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol is Cc1cc(C(F)(F)F)cc(O)c1-c1ccc(NC2CNCC(F)(F)C2)nn1.
What is the InChIKey of 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol?
The InChIKey is XUJSDUINYJMZDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F5N4O/c1-9-4-10(17(20,21)22)5-13(27)15(9)12-2-3-14(26-25-12)24-11-6-16(18,19)8-23-7-11/h2-5,11,23,27H,6-8H2,1H3,(H,24,26).
What are the key properties of 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol?
2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol has a molecular weight of 388.34 g/mol, XLogP of 3.59, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[(5,5-difluoropiperidin-3-yl)amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethyl)phenol is sourced from PubChem (CID 155284548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).