C12H19ClN4O — CID 155284658
2-[3-[(6-chloro-4-methylpyridazin-3-yl)amino]piperidin-1-yl]ethanol (PubChem CID 155284658) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[3-[(6-chloro-4-methylpyridazin-3-yl)amino]piperidin-1-yl]ethanol.
| Compound Name | 2-[3-[(6-chloro-4-methylpyridazin-3-yl)amino]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 155284658 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[3-[(6-chloro-4-methylpyridazin-3-yl)amino]piperidin-1-yl]ethanol |
| SMILES | Cc1cc(Cl)nnc1NC1CCCN(CCO)C1 |
| InChI | InChI=1S/C12H19ClN4O/c1-9-7-11(13)15-16-12(9)14-10-3-2-4-17(8-10)5-6-18/h7,10,18H,2-6,8H2,1H3,(H,14,16) |
| InChIKey | QGALYFBANQYRJZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |