About 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole
7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole (PubChem CID 155285035) has the molecular formula C25H20ClFN4O
and a molecular weight of 446.91 g/mol. Its IUPAC name is 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole.
Molecular Properties
| Compound Name | 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole |
| PubChem CID | 155285035 |
| Molecular Formula | C25H20ClFN4O |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole |
| SMILES | Fc1ccc(-n2c(C3CCOCC3)c(-c3ccc(Cl)nc3)c3cc4[nH]ncc4cc32)cc1 |
| InChI | InChI=1S/C25H20ClFN4O/c26-23-6-1-16(13-28-23)24-20-12-21-17(14-29-30-21)11-22(20)31(19-4-2-18(27)3-5-19)25(24)15-7-9-32-10-8-15/h1-6,11-15H,7-10H2,(H,29,30) |
| InChIKey | FVUOEWBBIVBUQO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole?
The IUPAC name of 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole (CID 155285035) is 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole.
What is the SMILES notation for 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole?
The canonical SMILES for 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole is Fc1ccc(-n2c(C3CCOCC3)c(-c3ccc(Cl)nc3)c3cc4[nH]ncc4cc32)cc1.
What is the InChIKey of 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole?
The InChIKey is FVUOEWBBIVBUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20ClFN4O/c26-23-6-1-16(13-28-23)24-20-12-21-17(14-29-30-21)11-22(20)31(19-4-2-18(27)3-5-19)25(24)15-7-9-32-10-8-15/h1-6,11-15H,7-10H2,(H,29,30).
What are the key properties of 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole?
7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole has a molecular weight of 446.91 g/mol, XLogP of 6.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(6-chloro-3-pyridinyl)-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazole is sourced from PubChem (CID 155285035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).