C33H30FN3O9 — CID 155285045
(2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 155285045) has the molecular formula C33H30FN3O9 and a molecular weight of 631.61 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 155285045 |
| Molecular Formula | C33H30FN3O9 |
| Molecular Weight | 631.61 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | (2S,3S,4S,5R)-6-[4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(OC1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)c1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cc4cn[nH]c4cc23)cc1 |
| InChI | InChI=1S/C33H30FN3O9/c34-20-5-7-21(8-6-20)37-24-13-19-15-35-36-23(19)14-22(24)25(26(37)17-9-11-44-12-10-17)16-1-3-18(4-2-16)32(43)46-33-29(40)27(38)28(39)30(45-33)31(41)42/h1-8,13-15,17,27-30,33,38-40H,9-12H2,(H,35,36)(H,41,42)/t27-,28-,29+,30-,33?/m0/s1 |
| InChIKey | XPUJCCIIPZMZBZ-FAELXZLPSA-N |
| XLogP | 3.26 |
| TPSA | 176.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |