C15H19F2NO3 — CID 155286375
(5R,6R)-6-[(3,3-difluorocyclobutyl)methylamino]-5,6,7,8-tetrahydronaphthalene-1,2,5-triol (PubChem CID 155286375) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is (5R,6R)-6-[(3,3-difluorocyclobutyl)methylamino]-5,6,7,8-tetrahydronaphthalene-1,2,5-triol.
| Compound Name | (5R,6R)-6-[(3,3-difluorocyclobutyl)methylamino]-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
|---|---|
| PubChem CID | 155286375 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (5R,6R)-6-[(3,3-difluorocyclobutyl)methylamino]-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
| SMILES | Oc1ccc2c(c1O)CC[C@@H](NCC1CC(F)(F)C1)[C@@H]2O |
| InChI | InChI=1S/C15H19F2NO3/c16-15(17)5-8(6-15)7-18-11-3-1-10-9(13(11)20)2-4-12(19)14(10)21/h2,4,8,11,13,18-21H,1,3,5-7H2/t11-,13-/m1/s1 |
| InChIKey | BPELBQWDPXGOEU-DGCLKSJQSA-N |
| XLogP | 2.08 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|