C14H25F2NO3 — CID 155286446
(2R,3R,4R,5S)-1-[2-(4,4-difluorocyclohexyl)ethyl]-2-methylpiperidine-3,4,5-triol (PubChem CID 155286446) has the molecular formula C14H25F2NO3 and a molecular weight of 293.35 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-(4,4-difluorocyclohexyl)ethyl]-2-methylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[2-(4,4-difluorocyclohexyl)ethyl]-2-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286446 |
| Molecular Formula | C14H25F2NO3 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-(4,4-difluorocyclohexyl)ethyl]-2-methylpiperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H25F2NO3/c1-9-12(19)13(20)11(18)8-17(9)7-4-10-2-5-14(15,16)6-3-10/h9-13,18-20H,2-8H2,1H3/t9-,11+,12-,13-/m1/s1 |
| InChIKey | YXPZIPXZZFGXHV-GWNIPJSYSA-N |
| XLogP | 0.99 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |