C17H24F3N3O3 — CID 155286458
(2R,3R,4R,5S)-2-methyl-1-[[1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 155286458) has the molecular formula C17H24F3N3O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-1-[[1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-1-[[1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286458 |
| Molecular Formula | C17H24F3N3O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-1-[[1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CC1CCN(c2cncc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H24F3N3O3/c1-10-15(25)16(26)14(24)9-23(10)8-11-2-3-22(7-11)13-4-12(5-21-6-13)17(18,19)20/h4-6,10-11,14-16,24-26H,2-3,7-9H2,1H3/t10-,11?,14+,15-,16-/m1/s1 |
| InChIKey | HLUYSCQVPLEYHP-RUYHENDASA-N |
| XLogP | 0.71 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |