C15H27NO3 — CID 155286460
(2R,3R,4R,5S)-1-[(4-ethenylcyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol (PubChem CID 155286460) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[(4-ethenylcyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[(4-ethenylcyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286460 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (2R,3R,4R,5S)-1-[(4-ethenylcyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol |
| SMILES | C=CC1CCC(CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2C)CC1 |
| InChI | InChI=1S/C15H27NO3/c1-3-11-4-6-12(7-5-11)8-16-9-13(17)15(19)14(18)10(16)2/h3,10-15,17-19H,1,4-9H2,2H3/t10-,11?,12?,13+,14-,15-/m1/s1 |
| InChIKey | LWXVMAOBOYVCTE-GMCFEXABSA-N |
| XLogP | 0.77 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|