C16H24F3N3O3S — CID 155286470
(2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 155286470) has the molecular formula C16H24F3N3O3S and a molecular weight of 395.45 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286470 |
| Molecular Formula | C16H24F3N3O3S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-1-[[(3S)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1C[C@@H]1CCCN(c2nc(C(F)(F)F)cs2)C1 |
| InChI | InChI=1S/C16H24F3N3O3S/c1-9-13(24)14(25)11(23)7-22(9)6-10-3-2-4-21(5-10)15-20-12(8-26-15)16(17,18)19/h8-11,13-14,23-25H,2-7H2,1H3/t9-,10-,11+,13-,14-/m1/s1 |
| InChIKey | XSGVYWKSQODDDW-KHQUWSPVSA-N |
| XLogP | 1.17 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |