About 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde
6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 155286489) has the molecular formula C11H14F2O2
and a molecular weight of 216.23 g/mol. Its IUPAC name is 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 155286489 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCCCOC1(F)C=CC=C(F)C1C=O |
| InChI | InChI=1S/C11H14F2O2/c1-2-3-7-15-11(13)6-4-5-10(12)9(11)8-14/h4-6,8-9H,2-3,7H2,1H3 |
| InChIKey | PINCIKHUOILDJQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde (CID 155286489) is 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde is CCCCOC1(F)C=CC=C(F)C1C=O.
What is the InChIKey of 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is PINCIKHUOILDJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O2/c1-2-3-7-15-11(13)6-4-5-10(12)9(11)8-14/h4-6,8-9H,2-3,7H2,1H3.
What are the key properties of 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde?
6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 216.23 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxy-2,6-difluorocyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 155286489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).