C18H26F3N3O3 — CID 155286509
(2R,3R,4R,5S)-2-methyl-1-[[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]piperidine-3,4,5-triol (PubChem CID 155286509) has the molecular formula C18H26F3N3O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-methyl-1-[[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-methyl-1-[[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286509 |
| Molecular Formula | C18H26F3N3O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (2R,3R,4R,5S)-2-methyl-1-[[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]methyl]piperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CC1CCCN(c2cccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C18H26F3N3O3/c1-11-16(26)17(27)13(25)10-24(11)9-12-4-3-7-23(8-12)15-6-2-5-14(22-15)18(19,20)21/h2,5-6,11-13,16-17,25-27H,3-4,7-10H2,1H3/t11-,12?,13+,16-,17-/m1/s1 |
| InChIKey | UWEWKAXXRYGIRO-OGLPCCOCSA-N |
| XLogP | 1.10 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |