C13H23F2NO3 — CID 155286544
(2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol (PubChem CID 155286544) has the molecular formula C13H23F2NO3 and a molecular weight of 279.33 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286544 |
| Molecular Formula | C13H23F2NO3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2R,3R,4R,5S)-1-[(4,4-difluorocyclohexyl)methyl]-2-methylpiperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H23F2NO3/c1-8-11(18)12(19)10(17)7-16(8)6-9-2-4-13(14,15)5-3-9/h8-12,17-19H,2-7H2,1H3/t8-,10+,11-,12-/m1/s1 |
| InChIKey | DZFHQRJRSAAEQQ-SASUGWTJSA-N |
| XLogP | 0.60 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |