C15H20FNO5 — CID 155286572
(2R,3R,4R,5S)-1-[2-(6-fluoro-1,3-benzodioxol-5-yl)ethyl]-2-methylpiperidine-3,4,5-triol (PubChem CID 155286572) has the molecular formula C15H20FNO5 and a molecular weight of 313.33 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-(6-fluoro-1,3-benzodioxol-5-yl)ethyl]-2-methylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[2-(6-fluoro-1,3-benzodioxol-5-yl)ethyl]-2-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286572 |
| Molecular Formula | C15H20FNO5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-(6-fluoro-1,3-benzodioxol-5-yl)ethyl]-2-methylpiperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCc1cc2c(cc1F)OCO2 |
| InChI | InChI=1S/C15H20FNO5/c1-8-14(19)15(20)11(18)6-17(8)3-2-9-4-12-13(5-10(9)16)22-7-21-12/h4-5,8,11,14-15,18-20H,2-3,6-7H2,1H3/t8-,11+,14-,15-/m1/s1 |
| InChIKey | KRNOLHMFVXQUCN-VSTQALJGSA-N |
| XLogP | -0.12 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |