C14H19ClFNO3 — CID 155286600
(2R,3R,4R,5S)-1-[2-(5-chloro-2-fluorophenyl)ethyl]-2-methylpiperidine-3,4,5-triol (PubChem CID 155286600) has the molecular formula C14H19ClFNO3 and a molecular weight of 303.76 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[2-(5-chloro-2-fluorophenyl)ethyl]-2-methylpiperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[2-(5-chloro-2-fluorophenyl)ethyl]-2-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155286600 |
| Molecular Formula | C14H19ClFNO3 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R,3R,4R,5S)-1-[2-(5-chloro-2-fluorophenyl)ethyl]-2-methylpiperidine-3,4,5-triol |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H19ClFNO3/c1-8-13(19)14(20)12(18)7-17(8)5-4-9-6-10(15)2-3-11(9)16/h2-3,6,8,12-14,18-20H,4-5,7H2,1H3/t8-,12+,13-,14-/m1/s1 |
| InChIKey | WQXCKPKAUVELBV-DSMZTOPNSA-N |
| XLogP | 0.81 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |