C35H37F2NO4 — CID 155286656
[(2R,3R,4R,5S)-1-[2-(3,4-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol (PubChem CID 155286656) has the molecular formula C35H37F2NO4 and a molecular weight of 573.68 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-1-[2-(3,4-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5S)-1-[2-(3,4-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 155286656 |
| Molecular Formula | C35H37F2NO4 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | [(2R,3R,4R,5S)-1-[2-(3,4-difluorophenyl)ethyl]-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methanol |
| SMILES | OC[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1CCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C35H37F2NO4/c36-30-17-16-26(20-31(30)37)18-19-38-21-33(40-23-27-10-4-1-5-11-27)35(42-25-29-14-8-3-9-15-29)34(32(38)22-39)41-24-28-12-6-2-7-13-28/h1-17,20,32-35,39H,18-19,21-25H2/t32-,33+,34-,35-/m1/s1 |
| InChIKey | OHHTYIQFLAYAIM-AOJHZZQJSA-N |
| XLogP | 5.94 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |