C28H37N5O9 — CID 155286808
2-[4-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-N-methoxycarbonylanilino]acetic acid (PubChem CID 155286808) has the molecular formula C28H37N5O9 and a molecular weight of 587.63 g/mol. Its IUPAC name is 2-[4-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-N-methoxycarbonylanilino]acetic acid.
| Compound Name | 2-[4-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-N-methoxycarbonylanilino]acetic acid |
|---|---|
| PubChem CID | 155286808 |
| Molecular Formula | C28H37N5O9 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 2-[4-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]-N-methoxycarbonylanilino]acetic acid |
| SMILES | COC(=O)N(CC(=O)O)c1ccc(NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C28H37N5O9/c1-17(2)25(31-21(34)8-6-5-7-15-32-22(35)13-14-23(32)36)27(40)29-18(3)26(39)30-19-9-11-20(12-10-19)33(16-24(37)38)28(41)42-4/h9-14,17-18,25H,5-8,15-16H2,1-4H3,(H,29,40)(H,30,39)(H,31,34)(H,37,38)/t18-,25-/m0/s1 |
| InChIKey | WFKHXGCSEXQTJP-BVZFJXPGSA-N |
| XLogP | 1.41 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|