About bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate
bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate (PubChem CID 155286898) has the molecular formula C9H10O7S2
and a molecular weight of 294.31 g/mol. Its IUPAC name is bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate.
Molecular Properties
| Compound Name | bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate |
| PubChem CID | 155286898 |
| Molecular Formula | C9H10O7S2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate |
| SMILES | O=C(OCC1CSC(=O)O1)OCC1CSC(=O)O1 |
| InChI | InChI=1S/C9H10O7S2/c10-7(13-1-5-3-17-8(11)15-5)14-2-6-4-18-9(12)16-6/h5-6H,1-4H2 |
| InChIKey | YSPVTPMJGVLEMW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate?
The IUPAC name of bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate (CID 155286898) is bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate.
What is the SMILES notation for bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate?
The canonical SMILES for bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate is O=C(OCC1CSC(=O)O1)OCC1CSC(=O)O1.
What is the InChIKey of bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate?
The InChIKey is YSPVTPMJGVLEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O7S2/c10-7(13-1-5-3-17-8(11)15-5)14-2-6-4-18-9(12)16-6/h5-6H,1-4H2.
What are the key properties of bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate?
bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate has a molecular weight of 294.31 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2-oxo-1,3-oxathiolan-5-yl)methyl] carbonate is sourced from PubChem (CID 155286898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).