C9H18FNO — CID 155287273
(3R,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 155287273) has the molecular formula C9H18FNO and a molecular weight of 175.25 g/mol. Its IUPAC name is (3R,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | (3R,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 155287273 |
| Molecular Formula | C9H18FNO |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (3R,4S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)C[C@H](O)[C@H](F)C(C)(C)N1 |
| InChI | InChI=1S/C9H18FNO/c1-8(2)5-6(12)7(10)9(3,4)11-8/h6-7,11-12H,5H2,1-4H3/t6-,7-/m0/s1 |
| InChIKey | VGWSDMVKVCEELZ-BQBZGAKWSA-N |
| XLogP | 1.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |