C27H20FN7O — CID 155287610
5-ethynyl-18-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-6,11,13,15-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12,14,16-heptaen-16-amine (PubChem CID 155287610) has the molecular formula C27H20FN7O and a molecular weight of 477.50 g/mol. Its IUPAC name is 5-ethynyl-18-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-6,11,13,15-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12,14,16-heptaen-16-amine.
| Compound Name | 5-ethynyl-18-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-6,11,13,15-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12,14,16-heptaen-16-amine |
|---|---|
| PubChem CID | 155287610 |
| Molecular Formula | C27H20FN7O |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 5-ethynyl-18-[3-fluoro-4-(4-methylpyrimidin-2-yl)oxyphenyl]-6,11,13,15-tetrazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12,14,16-heptaen-16-amine |
| SMILES | C#Cc1ccc2c(n1)CCCn1c-2c(-c2ccc(Oc3nccc(C)n3)c(F)c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C27H20FN7O/c1-3-17-7-8-18-20(34-17)5-4-12-35-24(18)22(23-25(29)31-14-32-26(23)35)16-6-9-21(19(28)13-16)36-27-30-11-10-15(2)33-27/h1,6-11,13-14H,4-5,12H2,2H3,(H2,29,31,32) |
| InChIKey | JGXZXHIERCIBGG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|