C32H34ClF2NO6S2 — CID 155287980
[(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dihydroxy-4-methylthian-4-yl)methanone (PubChem CID 155287980) has the molecular formula C32H34ClF2NO6S2 and a molecular weight of 666.21 g/mol. Its IUPAC name is [(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dihydroxy-4-methylthian-4-yl)methanone.
| Compound Name | [(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dihydroxy-4-methylthian-4-yl)methanone |
|---|---|
| PubChem CID | 155287980 |
| Molecular Formula | C32H34ClF2NO6S2 |
| Molecular Weight | 666.21 g/mol |
| Exact Mass | 665.15 |
| IUPAC Name | [(3aR,9bR)-7-[(2-chloro-6-fluorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dihydroxy-4-methylthian-4-yl)methanone |
| SMILES | CC1(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(OCc5c(F)cccc5Cl)cc4CC[C@@H]23)CCS(O)(O)CC1 |
| InChI | InChI=1S/C32H34ClF2NO6S2/c1-31(14-17-43(38,39)18-15-31)30(37)36-16-13-32(44(40,41)24-9-6-22(34)7-10-24)26-11-8-23(19-21(26)5-12-29(32)36)42-20-25-27(33)3-2-4-28(25)35/h2-4,6-11,19,29,38-39H,5,12-18,20H2,1H3/t29-,32-/m1/s1 |
| InChIKey | RJTAOKYZRQJXAV-QLWXXVCSSA-N |
| XLogP | 6.96 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.21 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |