C28H24FN3O3 — CID 155288265
6-amino-N-[3-[3-(3-fluoro-4-formyl-5-methoxyphenyl)-2-methylphenyl]-2-methylphenyl]pyridine-3-carboxamide (PubChem CID 155288265) has the molecular formula C28H24FN3O3 and a molecular weight of 469.52 g/mol. Its IUPAC name is 6-amino-N-[3-[3-(3-fluoro-4-formyl-5-methoxyphenyl)-2-methylphenyl]-2-methylphenyl]pyridine-3-carboxamide.
| Compound Name | 6-amino-N-[3-[3-(3-fluoro-4-formyl-5-methoxyphenyl)-2-methylphenyl]-2-methylphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155288265 |
| Molecular Formula | C28H24FN3O3 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 6-amino-N-[3-[3-(3-fluoro-4-formyl-5-methoxyphenyl)-2-methylphenyl]-2-methylphenyl]pyridine-3-carboxamide |
| SMILES | COc1cc(-c2cccc(-c3cccc(NC(=O)c4ccc(N)nc4)c3C)c2C)cc(F)c1C=O |
| InChI | InChI=1S/C28H24FN3O3/c1-16-20(19-12-24(29)23(15-33)26(13-19)35-3)6-4-7-21(16)22-8-5-9-25(17(22)2)32-28(34)18-10-11-27(30)31-14-18/h4-15H,1-3H3,(H2,30,31)(H,32,34) |
| InChIKey | ILYDUIFAQDVGIB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|