C17H17NO2 — CID 15528845
(3aR,9bS)-1-benzyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole (PubChem CID 15528845) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (3aR,9bS)-1-benzyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole.
| Compound Name | (3aR,9bS)-1-benzyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole |
|---|---|
| PubChem CID | 15528845 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3aR,9bS)-1-benzyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole |
| SMILES | c1ccc(CN2OC[C@H]3COc4ccccc4[C@H]32)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-2-6-13(7-3-1)10-18-17-14(12-20-18)11-19-16-9-5-4-8-15(16)17/h1-9,14,17H,10-12H2/t14-,17+/m1/s1 |
| InChIKey | OIYDEXUCOXGYIK-PBHICJAKSA-N |
| XLogP | 3.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |