C52H72O4 — CID 15528901
8,9,18,19-tetraoctoxytricyclo[14.4.0.06,11]icosa-1,2,3,4,5,7,9,11,12,13,14,15,17,19-tetradecaene (PubChem CID 15528901) has the molecular formula C52H72O4 and a molecular weight of 761.14 g/mol. Its IUPAC name is 8,9,18,19-tetraoctoxytricyclo[14.4.0.06,11]icosa-1,2,3,4,5,7,9,11,12,13,14,15,17,19-tetradecaene.
| Compound Name | 8,9,18,19-tetraoctoxytricyclo[14.4.0.06,11]icosa-1,2,3,4,5,7,9,11,12,13,14,15,17,19-tetradecaene |
|---|---|
| PubChem CID | 15528901 |
| Molecular Formula | C52H72O4 |
| Molecular Weight | 761.14 g/mol |
| Exact Mass | 760.54 |
| IUPAC Name | 8,9,18,19-tetraoctoxytricyclo[14.4.0.06,11]icosa-1,2,3,4,5,7,9,11,12,13,14,15,17,19-tetradecaene |
| SMILES | CCCCCCCCOc1cc2c(cc1OCCCCCCCC)=C=C=C=C=c1cc(OCCCCCCCC)c(OCCCCCCCC)cc1=C=C=C=C=2 |
| InChI | InChI=1S/C52H72O4/c1-5-9-13-17-21-29-37-53-49-41-45-33-25-26-35-47-43-51(55-39-31-23-19-15-11-7-3)52(56-40-32-24-20-16-12-8-4)44-48(47)36-28-27-34-46(45)42-50(49)54-38-30-22-18-14-10-6-2/h41-44H,5-24,29-32,37-40H2,1-4H3 |
| InChIKey | FMARJFONHZSHBC-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.14 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|