C17H15N7O3S — CID 155289126
4-[[4-amino-6-(1H-indol-5-yloxy)-1,3,5-triazin-2-yl]amino]benzenesulfonamide (PubChem CID 155289126) has the molecular formula C17H15N7O3S and a molecular weight of 397.42 g/mol. Its IUPAC name is 4-[[4-amino-6-(1H-indol-5-yloxy)-1,3,5-triazin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-amino-6-(1H-indol-5-yloxy)-1,3,5-triazin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 155289126 |
| Molecular Formula | C17H15N7O3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-[[4-amino-6-(1H-indol-5-yloxy)-1,3,5-triazin-2-yl]amino]benzenesulfonamide |
| SMILES | Nc1nc(Nc2ccc(S(N)(=O)=O)cc2)nc(Oc2ccc3[nH]ccc3c2)n1 |
| InChI | InChI=1S/C17H15N7O3S/c18-15-22-16(21-11-1-4-13(5-2-11)28(19,25)26)24-17(23-15)27-12-3-6-14-10(9-12)7-8-20-14/h1-9,20H,(H2,19,25,26)(H3,18,21,22,23,24) |
| InChIKey | NLUNRZKTOSCDJH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |