About 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine
3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine (PubChem CID 155289177) has the molecular formula C10H11N6S+
and a molecular weight of 247.31 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine.
Molecular Properties
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine |
| PubChem CID | 155289177 |
| Molecular Formula | C10H11N6S+ |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine |
| SMILES | Cc1nc(C[n+]2cnc(N)c3[nH]cnc32)cs1 |
| InChI | InChI=1S/C10H10N6S/c1-6-15-7(3-17-6)2-16-5-14-9(11)8-10(16)13-4-12-8/h3-5H,2H2,1H3,(H2,11,12,13)/p+1 |
| InChIKey | ONVWEGJZYXSORW-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine?
The IUPAC name of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine (CID 155289177) is 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine.
What is the SMILES notation for 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine?
The canonical SMILES for 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine is Cc1nc(C[n+]2cnc(N)c3[nH]cnc32)cs1.
What is the InChIKey of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine?
The InChIKey is ONVWEGJZYXSORW-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H10N6S/c1-6-15-7(3-17-6)2-16-5-14-9(11)8-10(16)13-4-12-8/h3-5H,2H2,1H3,(H2,11,12,13)/p+1.
What are the key properties of 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine?
3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine has a molecular weight of 247.31 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methyl-1,3-thiazol-4-yl)methyl]-7H-purin-3-ium-6-amine is sourced from PubChem (CID 155289177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).