About N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide
N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide (PubChem CID 155289261) has the molecular formula C20H16N4O
and a molecular weight of 328.38 g/mol. Its IUPAC name is N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide.
Molecular Properties
| Compound Name | N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide |
| PubChem CID | 155289261 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(-c2ncnc3[nH]ccc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H16N4O/c25-20(16-4-2-1-3-5-16)22-12-14-6-8-15(9-7-14)18-17-10-11-21-19(17)24-13-23-18/h1-11,13H,12H2,(H,22,25)(H,21,23,24) |
| InChIKey | ZUWTWEPWXCWEFD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide?
The IUPAC name of N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide (CID 155289261) is N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide.
What is the SMILES notation for N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide?
The canonical SMILES for N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide is O=C(NCc1ccc(-c2ncnc3[nH]ccc23)cc1)c1ccccc1.
What is the InChIKey of N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide?
The InChIKey is ZUWTWEPWXCWEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O/c25-20(16-4-2-1-3-5-16)22-12-14-6-8-15(9-7-14)18-17-10-11-21-19(17)24-13-23-18/h1-11,13H,12H2,(H,22,25)(H,21,23,24).
What are the key properties of N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide?
N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide has a molecular weight of 328.38 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]methyl]benzamide is sourced from PubChem (CID 155289261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).