About rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide
rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide (PubChem CID 155289265) has the molecular formula C6H10N2Rh
and a molecular weight of 213.07 g/mol. Its IUPAC name is rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide.
Molecular Properties
| Compound Name | rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide |
| PubChem CID | 155289265 |
| Molecular Formula | C6H10N2Rh |
| Molecular Weight | 213.07 g/mol |
| Exact Mass | 212.99 |
| IUPAC Name | rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide |
| SMILES | Cc1cn(C)[c-][n+]1C.[Rh] |
| InChI | InChI=1S/C6H10N2.Rh/c1-6-4-7(2)5-8(6)3;/h4H,1-3H3; |
| InChIKey | LJGLFBNNDZSBLL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.07 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide?
The IUPAC name of rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide (CID 155289265) is rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide.
What is the SMILES notation for rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide?
The canonical SMILES for rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide is Cc1cn(C)[c-][n+]1C.[Rh].
What is the InChIKey of rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide?
The InChIKey is LJGLFBNNDZSBLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.Rh/c1-6-4-7(2)5-8(6)3;/h4H,1-3H3;.
What are the key properties of rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide?
rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide has a molecular weight of 213.07 g/mol, XLogP of -0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for rhodium;1,3,4-trimethyl-2H-imidazol-3-ium-2-ide is sourced from PubChem (CID 155289265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).