C22H26BrN3 — CID 155289391
1-(5-bromo-3-pyridinyl)-4-[(1R,4S)-4-(3-methylphenyl)cyclohex-2-en-1-yl]piperazine (PubChem CID 155289391) has the molecular formula C22H26BrN3 and a molecular weight of 412.38 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-4-[(1R,4S)-4-(3-methylphenyl)cyclohex-2-en-1-yl]piperazine.
| Compound Name | 1-(5-bromo-3-pyridinyl)-4-[(1R,4S)-4-(3-methylphenyl)cyclohex-2-en-1-yl]piperazine |
|---|---|
| PubChem CID | 155289391 |
| Molecular Formula | C22H26BrN3 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-4-[(1R,4S)-4-(3-methylphenyl)cyclohex-2-en-1-yl]piperazine |
| SMILES | Cc1cccc([C@@H]2C=C[C@H](N3CCN(c4cncc(Br)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C22H26BrN3/c1-17-3-2-4-19(13-17)18-5-7-21(8-6-18)25-9-11-26(12-10-25)22-14-20(23)15-24-16-22/h2-5,7,13-16,18,21H,6,8-12H2,1H3/t18-,21+/m1/s1 |
| InChIKey | DZSQRTQAFFIBEC-NQIIRXRSSA-N |
| XLogP | 4.78 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|