C30H29N5O2S2 — CID 155289405
N-[(1S)-5-[(2-methylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide (PubChem CID 155289405) has the molecular formula C30H29N5O2S2 and a molecular weight of 555.73 g/mol. Its IUPAC name is N-[(1S)-5-[(2-methylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-5-[(2-methylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155289405 |
| Molecular Formula | C30H29N5O2S2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | N-[(1S)-5-[(2-methylsulfanylbenzoyl)amino]-1-(5-naphthalen-2-yl-1H-imidazol-2-yl)pentyl]-1,3-thiazole-5-carboxamide |
| SMILES | CSc1ccccc1C(=O)NCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc3ccccc3c2)[nH]1 |
| InChI | InChI=1S/C30H29N5O2S2/c1-38-26-12-5-4-10-23(26)29(36)32-15-7-6-11-24(35-30(37)27-18-31-19-39-27)28-33-17-25(34-28)22-14-13-20-8-2-3-9-21(20)16-22/h2-5,8-10,12-14,16-19,24H,6-7,11,15H2,1H3,(H,32,36)(H,33,34)(H,35,37)/t24-/m0/s1 |
| InChIKey | IBVNIPPBTCWYJG-DEOSSOPVSA-N |
| XLogP | 6.48 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|